About (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide
(2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide (PubChem CID 159843119) has the molecular formula C10H19NO5S
and a molecular weight of 265.33 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide.
Molecular Properties
| Compound Name | (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide |
| PubChem CID | 159843119 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide |
| SMILES | CC(O)[C@H](C)C(=O)NC1CCCC1.O=S(=O)=O |
| InChI | InChI=1S/C10H19NO2.O3S/c1-7(8(2)12)10(13)11-9-5-3-4-6-9;1-4(2)3/h7-9,12H,3-6H2,1-2H3,(H,11,13);/t7-,8?;/m0./s1 |
| InChIKey | NOYBCTYIGTZSSC-JPPWUZRISA-N |
| XLogP | 0.06 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide?
The IUPAC name of (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide (CID 159843119) is (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide.
What is the SMILES notation for (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide?
The canonical SMILES for (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide is CC(O)[C@H](C)C(=O)NC1CCCC1.O=S(=O)=O.
What is the InChIKey of (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide?
The InChIKey is NOYBCTYIGTZSSC-JPPWUZRISA-N. The full InChI is InChI=1S/C10H19NO2.O3S/c1-7(8(2)12)10(13)11-9-5-3-4-6-9;1-4(2)3/h7-9,12H,3-6H2,1-2H3,(H,11,13);/t7-,8?;/m0./s1.
What are the key properties of (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide?
(2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide has a molecular weight of 265.33 g/mol, XLogP of 0.06, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-cyclopentyl-3-hydroxy-2-methylbutanamide;sulfur trioxide is sourced from PubChem (CID 159843119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).