C11H19NO2 — CID 130015263
(E)-N-cyclohexyl-2-hydroxypent-3-enamide (PubChem CID 130015263) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (E)-N-cyclohexyl-2-hydroxypent-3-enamide.
| Compound Name | (E)-N-cyclohexyl-2-hydroxypent-3-enamide |
|---|---|
| PubChem CID | 130015263 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (E)-N-cyclohexyl-2-hydroxypent-3-enamide |
| SMILES | C/C=C/C(O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H19NO2/c1-2-6-10(13)11(14)12-9-7-4-3-5-8-9/h2,6,9-10,13H,3-5,7-8H2,1H3,(H,12,14)/b6-2+ |
| InChIKey | XOONNNGOPGLTPU-QHHAFSJGSA-N |
| XLogP | 1.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|