C29H38N4O3 — CID 159843645
N-[6-ethyl-1-methyl-3-propan-2-yloxy-2-(5-pyrrolidin-1-ylpentanoyl)pyrrolo[2,3-b]pyridin-5-yl]benzamide (PubChem CID 159843645) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-[6-ethyl-1-methyl-3-propan-2-yloxy-2-(5-pyrrolidin-1-ylpentanoyl)pyrrolo[2,3-b]pyridin-5-yl]benzamide.
| Compound Name | N-[6-ethyl-1-methyl-3-propan-2-yloxy-2-(5-pyrrolidin-1-ylpentanoyl)pyrrolo[2,3-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 159843645 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | N-[6-ethyl-1-methyl-3-propan-2-yloxy-2-(5-pyrrolidin-1-ylpentanoyl)pyrrolo[2,3-b]pyridin-5-yl]benzamide |
| SMILES | CCc1nc2c(cc1NC(=O)c1ccccc1)c(OC(C)C)c(C(=O)CCCCN1CCCC1)n2C |
| InChI | InChI=1S/C29H38N4O3/c1-5-23-24(31-29(35)21-13-7-6-8-14-21)19-22-27(36-20(2)3)26(32(4)28(22)30-23)25(34)15-9-10-16-33-17-11-12-18-33/h6-8,13-14,19-20H,5,9-12,15-18H2,1-4H3,(H,31,35) |
| InChIKey | NOZYEJBAPRVLMK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|