About chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane
chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane (PubChem CID 159846563) has the molecular formula C4H11Cl7S2Si2
and a molecular weight of 427.61 g/mol. Its IUPAC name is chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane.
Molecular Properties
| Compound Name | chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane |
| PubChem CID | 159846563 |
| Molecular Formula | C4H11Cl7S2Si2 |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 423.77 |
| IUPAC Name | chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane |
| SMILES | CSCCl.CSC[Si](Cl)(Cl)Cl.Cl[SiH](Cl)Cl |
| InChI | InChI=1S/C2H5Cl3SSi.C2H5ClS.Cl3HSi/c1-6-2-7(3,4)5;1-4-2-3;1-4(2)3/h2H2,1H3;2H2,1H3;4H |
| InChIKey | NPJPKTXVHCNMEG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane?
The IUPAC name of chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane (CID 159846563) is chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane.
What is the SMILES notation for chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane?
The canonical SMILES for chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane is CSCCl.CSC[Si](Cl)(Cl)Cl.Cl[SiH](Cl)Cl.
What is the InChIKey of chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane?
The InChIKey is NPJPKTXVHCNMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5Cl3SSi.C2H5ClS.Cl3HSi/c1-6-2-7(3,4)5;1-4-2-3;1-4(2)3/h2H2,1H3;2H2,1H3;4H.
What are the key properties of chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane?
chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane has a molecular weight of 427.61 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(methylsulfanyl)methane;trichloro(methylsulfanylmethyl)silane;trichlorosilane is sourced from PubChem (CID 159846563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).