About trichloro(ethyl)silane;trichlorosilane
trichloro(ethyl)silane;trichlorosilane (PubChem CID 173057745) has the molecular formula C2H6Cl6Si2
and a molecular weight of 298.96 g/mol. Its IUPAC name is trichloro(ethyl)silane;trichlorosilane.
Molecular Properties
| Compound Name | trichloro(ethyl)silane;trichlorosilane |
| PubChem CID | 173057745 |
| Molecular Formula | C2H6Cl6Si2 |
| Molecular Weight | 298.96 g/mol |
| Exact Mass | 295.81 |
| IUPAC Name | trichloro(ethyl)silane;trichlorosilane |
| SMILES | CC[Si](Cl)(Cl)Cl.Cl[SiH](Cl)Cl |
| InChI | InChI=1S/C2H5Cl3Si.Cl3HSi/c1-2-6(3,4)5;1-4(2)3/h2H2,1H3;4H |
| InChIKey | OVFZOQGRHUZGPK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze trichloro(ethyl)silane;trichlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro(ethyl)silane;trichlorosilane?
The IUPAC name of trichloro(ethyl)silane;trichlorosilane (CID 173057745) is trichloro(ethyl)silane;trichlorosilane.
What is the SMILES notation for trichloro(ethyl)silane;trichlorosilane?
The canonical SMILES for trichloro(ethyl)silane;trichlorosilane is CC[Si](Cl)(Cl)Cl.Cl[SiH](Cl)Cl.
What is the InChIKey of trichloro(ethyl)silane;trichlorosilane?
The InChIKey is OVFZOQGRHUZGPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5Cl3Si.Cl3HSi/c1-2-6(3,4)5;1-4(2)3/h2H2,1H3;4H.
What are the key properties of trichloro(ethyl)silane;trichlorosilane?
trichloro(ethyl)silane;trichlorosilane has a molecular weight of 298.96 g/mol, XLogP of 4.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro(ethyl)silane;trichlorosilane is sourced from PubChem (CID 173057745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).