About potassium triethylsilylazanide
potassium triethylsilylazanide (PubChem CID 161419830) has the molecular formula C6H16KNSi
and a molecular weight of 169.38 g/mol. Its IUPAC name is potassium triethylsilylazanide.
Molecular Properties
| Compound Name | potassium triethylsilylazanide |
| PubChem CID | 161419830 |
| Molecular Formula | C6H16KNSi |
| Molecular Weight | 169.38 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | potassium triethylsilylazanide |
| SMILES | CC[Si]([NH-])(CC)CC.[K+] |
| InChI | InChI=1S/C6H16NSi.K/c1-4-8(7,5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 |
| InChIKey | VWOQZFVNHFAUND-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium triethylsilylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium triethylsilylazanide?
The IUPAC name of potassium triethylsilylazanide (CID 161419830) is potassium triethylsilylazanide.
What is the SMILES notation for potassium triethylsilylazanide?
The canonical SMILES for potassium triethylsilylazanide is CC[Si]([NH-])(CC)CC.[K+].
What is the InChIKey of potassium triethylsilylazanide?
The InChIKey is VWOQZFVNHFAUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16NSi.K/c1-4-8(7,5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1.
What are the key properties of potassium triethylsilylazanide?
potassium triethylsilylazanide has a molecular weight of 169.38 g/mol, XLogP of 0.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium triethylsilylazanide is sourced from PubChem (CID 161419830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).