About bromo-chloro-ethylsilane
bromo-chloro-ethylsilane (PubChem CID 154140952) has the molecular formula C2H6BrClSi
and a molecular weight of 173.51 g/mol. Its IUPAC name is bromo-chloro-ethylsilane.
Molecular Properties
| Compound Name | bromo-chloro-ethylsilane |
| PubChem CID | 154140952 |
| Molecular Formula | C2H6BrClSi |
| Molecular Weight | 173.51 g/mol |
| Exact Mass | 171.91 |
| IUPAC Name | bromo-chloro-ethylsilane |
| SMILES | CC[SiH](Cl)Br |
| InChI | InChI=1S/C2H6BrClSi/c1-2-5(3)4/h5H,2H2,1H3 |
| InChIKey | DTBHGMLUAPUDOE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze bromo-chloro-ethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo-chloro-ethylsilane?
The IUPAC name of bromo-chloro-ethylsilane (CID 154140952) is bromo-chloro-ethylsilane.
What is the SMILES notation for bromo-chloro-ethylsilane?
The canonical SMILES for bromo-chloro-ethylsilane is CC[SiH](Cl)Br.
What is the InChIKey of bromo-chloro-ethylsilane?
The InChIKey is DTBHGMLUAPUDOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6BrClSi/c1-2-5(3)4/h5H,2H2,1H3.
What are the key properties of bromo-chloro-ethylsilane?
bromo-chloro-ethylsilane has a molecular weight of 173.51 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo-chloro-ethylsilane is sourced from PubChem (CID 154140952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).