About 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane
1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane (PubChem CID 67277470) has the molecular formula C16H27Cl3Si
and a molecular weight of 353.84 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane.
Molecular Properties
| Compound Name | 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane |
| PubChem CID | 67277470 |
| Molecular Formula | C16H27Cl3Si |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane |
| SMILES | C1=C(C2=CCCCCC2)CCCCC1.CC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C14H22.C2H5Cl3Si/c1-2-6-10-13(9-5-1)14-11-7-3-4-8-12-14;1-2-6(3,4)5/h9,11H,1-8,10,12H2;2H2,1H3 |
| InChIKey | XTNIJSRARDCWAB-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane?
The IUPAC name of 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane (CID 67277470) is 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane.
What is the SMILES notation for 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane?
The canonical SMILES for 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane is C1=C(C2=CCCCCC2)CCCCC1.CC[Si](Cl)(Cl)Cl.
What is the InChIKey of 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane?
The InChIKey is XTNIJSRARDCWAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.C2H5Cl3Si/c1-2-6-10-13(9-5-1)14-11-7-3-4-8-12-14;1-2-6(3,4)5/h9,11H,1-8,10,12H2;2H2,1H3.
What are the key properties of 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane?
1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane has a molecular weight of 353.84 g/mol, XLogP of 7.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohepten-1-yl)cycloheptene;trichloro(ethyl)silane is sourced from PubChem (CID 67277470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).