C12H23NO — CID 175982380
N,N-diethylcycloocten-1-amine oxide (PubChem CID 175982380) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is N,N-diethylcycloocten-1-amine oxide.
| Compound Name | N,N-diethylcycloocten-1-amine oxide |
|---|---|
| PubChem CID | 175982380 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N,N-diethylcycloocten-1-amine oxide |
| SMILES | CC[N+]([O-])(CC)C1=CCCCCCC1 |
| InChI | InChI=1S/C12H23NO/c1-3-13(14,4-2)12-10-8-6-5-7-9-11-12/h10H,3-9,11H2,1-2H3 |
| InChIKey | IYKWCMPDYQDCDO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|