C11H16 — CID 71408872
bicyclo[5.2.2]undeca-1,6-diene (PubChem CID 71408872) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is bicyclo[5.2.2]undeca-1,6-diene.
| Compound Name | bicyclo[5.2.2]undeca-1,6-diene |
|---|---|
| PubChem CID | 71408872 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | bicyclo[5.2.2]undeca-1,6-diene |
| SMILES | C1=C2CCC(=CCCC1)CC2 |
| InChI | InChI=1S/C11H16/c1-2-4-10-6-8-11(5-3-1)9-7-10/h4-5H,1-3,6-9H2/b10-4-,11-5- |
| InChIKey | SRYUZPSZGDEMDG-GGXLTUIBSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|