C44H78O2 — CID 161454601
bis(1-(cyclohepten-1-yl)cycloheptene);1,1-di(propan-2-yloxy)decane (PubChem CID 161454601) has the molecular formula C44H78O2 and a molecular weight of 639.11 g/mol. Its IUPAC name is bis(1-(cyclohepten-1-yl)cycloheptene);1,1-di(propan-2-yloxy)decane.
| Compound Name | bis(1-(cyclohepten-1-yl)cycloheptene);1,1-di(propan-2-yloxy)decane |
|---|---|
| PubChem CID | 161454601 |
| Molecular Formula | C44H78O2 |
| Molecular Weight | 639.11 g/mol |
| Exact Mass | 638.60 |
| IUPAC Name | bis(1-(cyclohepten-1-yl)cycloheptene);1,1-di(propan-2-yloxy)decane |
| SMILES | C1=C(C2=CCCCCC2)CCCCC1.C1=C(C2=CCCCCC2)CCCCC1.CCCCCCCCCC(OC(C)C)OC(C)C |
| InChI | InChI=1S/C16H34O2.2C14H22/c1-6-7-8-9-10-11-12-13-16(17-14(2)3)18-15(4)5;2*1-2-6-10-13(9-5-1)14-11-7-3-4-8-12-14/h14-16H,6-13H2,1-5H3;2*9,11H,1-8,10,12H2 |
| InChIKey | WAZHPAMFESUFLN-UHFFFAOYSA-N |
| XLogP | 14.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.11 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|