C18H34O3 — CID 150382161
1-(1,1,1-trimethoxynonan-2-yl)cyclohexene (PubChem CID 150382161) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-(1,1,1-trimethoxynonan-2-yl)cyclohexene.
| Compound Name | 1-(1,1,1-trimethoxynonan-2-yl)cyclohexene |
|---|---|
| PubChem CID | 150382161 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 1-(1,1,1-trimethoxynonan-2-yl)cyclohexene |
| SMILES | CCCCCCCC(C1=CCCCC1)C(OC)(OC)OC |
| InChI | InChI=1S/C18H34O3/c1-5-6-7-8-12-15-17(16-13-10-9-11-14-16)18(19-2,20-3)21-4/h13,17H,5-12,14-15H2,1-4H3 |
| InChIKey | GZYVLOMZDKLNOL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|