About butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate
butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate (PubChem CID 159848071) has the molecular formula C19H30O6
and a molecular weight of 354.44 g/mol. Its IUPAC name is butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
| PubChem CID | 159848071 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(C)OC(=O)C(=C)C.C=CC(=O)OCCCC |
| InChI | InChI=1S/C12H18O4.C7H12O2/c1-8(2)11(13)15-7-6-10(5)16-12(14)9(3)4;1-3-5-6-9-7(8)4-2/h10H,1,3,6-7H2,2,4-5H3;4H,2-3,5-6H2,1H3 |
| InChIKey | NPOLSOKVOSCQBE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate?
The IUPAC name of butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate (CID 159848071) is butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate.
What is the SMILES notation for butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate?
The canonical SMILES for butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCC(C)OC(=O)C(=C)C.C=CC(=O)OCCCC.
What is the InChIKey of butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate?
The InChIKey is NPOLSOKVOSCQBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4.C7H12O2/c1-8(2)11(13)15-7-6-10(5)16-12(14)9(3)4;1-3-5-6-9-7(8)4-2/h10H,1,3,6-7H2,2,4-5H3;4H,2-3,5-6H2,1H3.
What are the key properties of butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate?
butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate has a molecular weight of 354.44 g/mol, XLogP of 3.52, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl prop-2-enoate;3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate is sourced from PubChem (CID 159848071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).