C29H33N3O8 — CID 159848285
methyl 3-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylimino]ethyl]-1-benzofuran-2-carbonyl]amino]benzoate (PubChem CID 159848285) has the molecular formula C29H33N3O8 and a molecular weight of 551.60 g/mol. Its IUPAC name is methyl 3-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylimino]ethyl]-1-benzofuran-2-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylimino]ethyl]-1-benzofuran-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 159848285 |
| Molecular Formula | C29H33N3O8 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | methyl 3-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylimino]ethyl]-1-benzofuran-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cc3cc(CC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)ccc3o2)c1 |
| InChI | InChI=1S/C29H33N3O8/c1-28(2,3)39-26(35)31-23(32-27(36)40-29(4,5)6)14-17-11-12-21-19(13-17)16-22(38-21)24(33)30-20-10-8-9-18(15-20)25(34)37-7/h8-13,15-16H,14H2,1-7H3,(H,30,33)(H,31,32,35,36) |
| InChIKey | NPPBTVLXMFMTON-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|