C26H50N2O4S2 — CID 159848608
tert-butyl 2-[1-[(2-sulfanylethylamino)methyl]cyclohexyl]acetate;2-[1-[(2-sulfanylethylamino)methyl]cyclohexyl]acetic acid (PubChem CID 159848608) has the molecular formula C26H50N2O4S2 and a molecular weight of 518.83 g/mol. Its IUPAC name is tert-butyl 2-[1-[(2-sulfanylethylamino)methyl]cyclohexyl]acetate;2-[1-[(2-sulfanylethylamino)methyl]cyclohexyl]acetic acid.
| Compound Name | tert-butyl 2-[1-[(2-sulfanylethylamino)methyl]cyclohexyl]acetate;2-[1-[(2-sulfanylethylamino)methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 159848608 |
| Molecular Formula | C26H50N2O4S2 |
| Molecular Weight | 518.83 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | tert-butyl 2-[1-[(2-sulfanylethylamino)methyl]cyclohexyl]acetate;2-[1-[(2-sulfanylethylamino)methyl]cyclohexyl]acetic acid |
| SMILES | CC(C)(C)OC(=O)CC1(CNCCS)CCCCC1.O=C(O)CC1(CNCCS)CCCCC1 |
| InChI | InChI=1S/C15H29NO2S.C11H21NO2S/c1-14(2,3)18-13(17)11-15(12-16-9-10-19)7-5-4-6-8-15;13-10(14)8-11(9-12-6-7-15)4-2-1-3-5-11/h16,19H,4-12H2,1-3H3;12,15H,1-9H2,(H,13,14) |
| InChIKey | NPQDBNZGONBIPZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.83 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|