C19H21N3O — CID 159848656
5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(2-phenylpropyl)pyridin-2-amine (PubChem CID 159848656) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(2-phenylpropyl)pyridin-2-amine.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(2-phenylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 159848656 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(2-phenylpropyl)pyridin-2-amine |
| SMILES | Cc1noc(C)c1-c1cnc(N)c(CC(C)c2ccccc2)c1 |
| InChI | InChI=1S/C19H21N3O/c1-12(15-7-5-4-6-8-15)9-16-10-17(11-21-19(16)20)18-13(2)22-23-14(18)3/h4-8,10-12H,9H2,1-3H3,(H2,20,21) |
| InChIKey | IZLVHSQLIITXMM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |