C18H23NO3 — CID 159852596
[2-[1-[(E)-but-2-enoyl]piperidin-4-yl]-1,1,2,2-tetradeuterioethyl] benzoate (PubChem CID 159852596) has the molecular formula C18H23NO3 and a molecular weight of 305.41 g/mol. Its IUPAC name is [2-[1-[(E)-but-2-enoyl]piperidin-4-yl]-1,1,2,2-tetradeuterioethyl] benzoate.
| Compound Name | [2-[1-[(E)-but-2-enoyl]piperidin-4-yl]-1,1,2,2-tetradeuterioethyl] benzoate |
|---|---|
| PubChem CID | 159852596 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | [2-[1-[(E)-but-2-enoyl]piperidin-4-yl]-1,1,2,2-tetradeuterioethyl] benzoate |
| SMILES | [2H]C([2H])(OC(=O)c1ccccc1)C([2H])([2H])C1CCN(C(=O)/C=C/C)CC1 |
| InChI | InChI=1S/C18H23NO3/c1-2-6-17(20)19-12-9-15(10-13-19)11-14-22-18(21)16-7-4-3-5-8-16/h2-8,15H,9-14H2,1H3/b6-2+/i11D2,14D2 |
| InChIKey | BVTZTFHPIMGSQU-CBISVJSASA-N |
| XLogP | 3.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|