C42H39BBrN6O4 — CID 159855292
CID 159855292 (PubChem CID 159855292) has the molecular formula C42H39BBrN6O4 and a molecular weight of 782.53 g/mol.
| Compound Name | CID 159855292 |
|---|---|
| PubChem CID | 159855292 |
| Molecular Formula | C42H39BBrN6O4 |
| Molecular Weight | 782.53 g/mol |
| Exact Mass | 781.23 |
| IUPAC Name | — |
| SMILES | CCc1c(-c2ccc(O)cc2)cnc(N)c1-c1ccc2c(c1)CN=C2.CCc1c(-c2ccc(O)cc2)cnc(N)c1Br.O[B]Oc1ccc2c(c1)CN=C2 |
| InChI | InChI=1S/C21H19N3O.C13H13BrN2O.C8H7BNO2/c1-2-18-19(13-5-7-17(25)8-6-13)12-24-21(22)20(18)14-3-4-15-10-23-11-16(15)9-14;1-2-10-11(7-16-13(15)12(10)14)8-3-5-9(17)6-4-8;11-9-12-8-2-1-6-4-10-5-7(6)3-8/h3-10,12,25H,2,11H2,1H3,(H2,22,24);3-7,17H,2H2,1H3,(H2,15,16);1-4,11H,5H2 |
| InChIKey | GPLAVMIGJQTDIL-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 172.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.53 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|