C26H31N3O4 — CID 166554986
tert-butyl N-[2-[4-[2-amino-4-ethyl-5-(4-hydroxyphenyl)-3-pyridinyl]phenoxy]ethyl]carbamate (PubChem CID 166554986) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-amino-4-ethyl-5-(4-hydroxyphenyl)-3-pyridinyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[2-amino-4-ethyl-5-(4-hydroxyphenyl)-3-pyridinyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166554986 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | tert-butyl N-[2-[4-[2-amino-4-ethyl-5-(4-hydroxyphenyl)-3-pyridinyl]phenoxy]ethyl]carbamate |
| SMILES | CCc1c(-c2ccc(O)cc2)cnc(N)c1-c1ccc(OCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H31N3O4/c1-5-21-22(17-6-10-19(30)11-7-17)16-29-24(27)23(21)18-8-12-20(13-9-18)32-15-14-28-25(31)33-26(2,3)4/h6-13,16,30H,5,14-15H2,1-4H3,(H2,27,29)(H,28,31) |
| InChIKey | OOBUBTUTJWSNEU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|