C34H46O3 — CID 159857571
2-(4-methylphenyl)acetaldehyde;3-methyl-1-phenylpentan-3-ol;2-methyl-3-(4-propan-2-ylphenyl)propanal (PubChem CID 159857571) has the molecular formula C34H46O3 and a molecular weight of 502.74 g/mol. Its IUPAC name is 2-(4-methylphenyl)acetaldehyde;3-methyl-1-phenylpentan-3-ol;2-methyl-3-(4-propan-2-ylphenyl)propanal.
| Compound Name | 2-(4-methylphenyl)acetaldehyde;3-methyl-1-phenylpentan-3-ol;2-methyl-3-(4-propan-2-ylphenyl)propanal |
|---|---|
| PubChem CID | 159857571 |
| Molecular Formula | C34H46O3 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 2-(4-methylphenyl)acetaldehyde;3-methyl-1-phenylpentan-3-ol;2-methyl-3-(4-propan-2-ylphenyl)propanal |
| SMILES | CC(C=O)Cc1ccc(C(C)C)cc1.CCC(C)(O)CCc1ccccc1.Cc1ccc(CC=O)cc1 |
| InChI | InChI=1S/C13H18O.C12H18O.C9H10O/c1-10(2)13-6-4-12(5-7-13)8-11(3)9-14;1-3-12(2,13)10-9-11-7-5-4-6-8-11;1-8-2-4-9(5-3-8)6-7-10/h4-7,9-11H,8H2,1-3H3;4-8,13H,3,9-10H2,1-2H3;2-5,7H,6H2,1H3 |
| InChIKey | NQSJWTVDXBKPCQ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|