C36H39ClN6O8 — CID 159864256
2-chloro-2-(3-nitrophenyl)acetonitrile;3-hexyl-6-(3-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carbonitrile;1-hexylpyrrole-2,5-dione (PubChem CID 159864256) has the molecular formula C36H39ClN6O8 and a molecular weight of 719.20 g/mol. Its IUPAC name is 2-chloro-2-(3-nitrophenyl)acetonitrile;3-hexyl-6-(3-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carbonitrile;1-hexylpyrrole-2,5-dione.
| Compound Name | 2-chloro-2-(3-nitrophenyl)acetonitrile;3-hexyl-6-(3-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carbonitrile;1-hexylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 159864256 |
| Molecular Formula | C36H39ClN6O8 |
| Molecular Weight | 719.20 g/mol |
| Exact Mass | 718.25 |
| IUPAC Name | 2-chloro-2-(3-nitrophenyl)acetonitrile;3-hexyl-6-(3-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carbonitrile;1-hexylpyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C2C(C1=O)C2(C#N)c1cccc([N+](=O)[O-])c1.CCCCCCN1C(=O)C=CC1=O.N#CC(Cl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O4.C10H15NO2.C8H5ClN2O2/c1-2-3-4-5-9-20-16(22)14-15(17(20)23)18(14,11-19)12-7-6-8-13(10-12)21(24)25;1-2-3-4-5-8-11-9(12)6-7-10(11)13;9-8(5-10)6-2-1-3-7(4-6)11(12)13/h6-8,10,14-15H,2-5,9H2,1H3;6-7H,2-5,8H2,1H3;1-4,8H |
| InChIKey | NRNMULTUFHKYIR-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 208.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.20 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|