C11H21F6NO4P- — CID 159866506
tert-butyl-(1,1,1,6,6,6-hexafluoro-3-methylhexan-3-yl)azanide;phosphoric acid (PubChem CID 159866506) has the molecular formula C11H21F6NO4P- and a molecular weight of 376.25 g/mol. Its IUPAC name is tert-butyl-(1,1,1,6,6,6-hexafluoro-3-methylhexan-3-yl)azanide;phosphoric acid.
| Compound Name | tert-butyl-(1,1,1,6,6,6-hexafluoro-3-methylhexan-3-yl)azanide;phosphoric acid |
|---|---|
| PubChem CID | 159866506 |
| Molecular Formula | C11H21F6NO4P- |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | tert-butyl-(1,1,1,6,6,6-hexafluoro-3-methylhexan-3-yl)azanide;phosphoric acid |
| SMILES | CC(C)(C)[N-]C(C)(CCC(F)(F)F)CC(F)(F)F.O=P(O)(O)O |
| InChI | InChI=1S/C11H18F6N.H3O4P/c1-8(2,3)18-9(4,7-11(15,16)17)5-6-10(12,13)14;1-5(2,3)4/h5-7H2,1-4H3;(H3,1,2,3,4)/q-1; |
| InChIKey | NRUIBJQRXAQXLO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|