C8H13F6O3P — CID 87156096
[1,1,1-trifluoro-3-(2,2,2-trifluoroethyl)hexan-3-yl]phosphonic acid (PubChem CID 87156096) has the molecular formula C8H13F6O3P and a molecular weight of 302.15 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-(2,2,2-trifluoroethyl)hexan-3-yl]phosphonic acid.
| Compound Name | [1,1,1-trifluoro-3-(2,2,2-trifluoroethyl)hexan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 87156096 |
| Molecular Formula | C8H13F6O3P |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [1,1,1-trifluoro-3-(2,2,2-trifluoroethyl)hexan-3-yl]phosphonic acid |
| SMILES | CCCC(CC(F)(F)F)(CC(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C8H13F6O3P/c1-2-3-6(18(15,16)17,4-7(9,10)11)5-8(12,13)14/h2-5H2,1H3,(H2,15,16,17) |
| InChIKey | VBBKLDLLOYRHPX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|