C20H23N5O — CID 159867940
4-(7H-cyclopenta[d]pyrimidin-4-yl)-N-(4-ethylphenyl)piperazine-1-carboxamide (PubChem CID 159867940) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-(7H-cyclopenta[d]pyrimidin-4-yl)-N-(4-ethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(7H-cyclopenta[d]pyrimidin-4-yl)-N-(4-ethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 159867940 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 4-(7H-cyclopenta[d]pyrimidin-4-yl)-N-(4-ethylphenyl)piperazine-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCN(c3ncnc4c3C=CC4)CC2)cc1 |
| InChI | InChI=1S/C20H23N5O/c1-2-15-6-8-16(9-7-15)23-20(26)25-12-10-24(11-13-25)19-17-4-3-5-18(17)21-14-22-19/h3-4,6-9,14H,2,5,10-13H2,1H3,(H,23,26) |
| InChIKey | NRYVBHUMUJLYGL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |