C20H31N3O2 — CID 159868341
tert-butyl 2-(2-amino-5-ethylanilino)-6-azaspiro[3.4]octane-6-carboxylate (PubChem CID 159868341) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is tert-butyl 2-(2-amino-5-ethylanilino)-6-azaspiro[3.4]octane-6-carboxylate.
| Compound Name | tert-butyl 2-(2-amino-5-ethylanilino)-6-azaspiro[3.4]octane-6-carboxylate |
|---|---|
| PubChem CID | 159868341 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | tert-butyl 2-(2-amino-5-ethylanilino)-6-azaspiro[3.4]octane-6-carboxylate |
| SMILES | CCc1ccc(N)c(NC2CC3(CCN(C(=O)OC(C)(C)C)C3)C2)c1 |
| InChI | InChI=1S/C20H31N3O2/c1-5-14-6-7-16(21)17(10-14)22-15-11-20(12-15)8-9-23(13-20)18(24)25-19(2,3)4/h6-7,10,15,22H,5,8-9,11-13,21H2,1-4H3 |
| InChIKey | OGYZNPNZSMMZLA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|