C26H34N4O3 — CID 161235049
tert-butyl 2-[[2-amino-5-(4-methylphenyl)phenyl]carbamoyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 161235049) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is tert-butyl 2-[[2-amino-5-(4-methylphenyl)phenyl]carbamoyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[[2-amino-5-(4-methylphenyl)phenyl]carbamoyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 161235049 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | tert-butyl 2-[[2-amino-5-(4-methylphenyl)phenyl]carbamoyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | Cc1ccc(-c2ccc(N)c(NC(=O)N3CC4(CCN(C(=O)OC(C)(C)C)CC4)C3)c2)cc1 |
| InChI | InChI=1S/C26H34N4O3/c1-18-5-7-19(8-6-18)20-9-10-21(27)22(15-20)28-23(31)30-16-26(17-30)11-13-29(14-12-26)24(32)33-25(2,3)4/h5-10,15H,11-14,16-17,27H2,1-4H3,(H,28,31) |
| InChIKey | QHDWEFQECFHUNC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|