C24H28N4O3 — CID 158102281
cyclopropyl 2-[[2-amino-5-(4-methylphenyl)phenyl]carbamoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 158102281) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is cyclopropyl 2-[[2-amino-5-(4-methylphenyl)phenyl]carbamoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | cyclopropyl 2-[[2-amino-5-(4-methylphenyl)phenyl]carbamoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 158102281 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | cyclopropyl 2-[[2-amino-5-(4-methylphenyl)phenyl]carbamoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | Cc1ccc(-c2ccc(N)c(NC(=O)N3CC4CN(C(=O)OC5CC5)CC4C3)c2)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-15-2-4-16(5-3-15)17-6-9-21(25)22(10-17)26-23(29)27-11-18-13-28(14-19(18)12-27)24(30)31-20-7-8-20/h2-6,9-10,18-20H,7-8,11-14,25H2,1H3,(H,26,29) |
| InChIKey | FYHRJACGMZWWCP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|