C20H21FN4O2 — CID 135209736
N-[2-amino-5-(4-fluorophenyl)phenyl]-8-formyl-3,8-diazabicyclo[3.2.1]octane-3-carboxamide (PubChem CID 135209736) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is N-[2-amino-5-(4-fluorophenyl)phenyl]-8-formyl-3,8-diazabicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-8-formyl-3,8-diazabicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 135209736 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[2-amino-5-(4-fluorophenyl)phenyl]-8-formyl-3,8-diazabicyclo[3.2.1]octane-3-carboxamide |
| SMILES | Nc1ccc(-c2ccc(F)cc2)cc1NC(=O)N1CC2CCC(C1)N2C=O |
| InChI | InChI=1S/C20H21FN4O2/c21-15-4-1-13(2-5-15)14-3-8-18(22)19(9-14)23-20(27)24-10-16-6-7-17(11-24)25(16)12-26/h1-5,8-9,12,16-17H,6-7,10-11,22H2,(H,23,27) |
| InChIKey | IOIQPARZCAFACT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|