C19H26N4O2 — CID 89183175
(3S)-3-acetamido-N-[2-amino-5-(cyclohexen-1-yl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 89183175) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (3S)-3-acetamido-N-[2-amino-5-(cyclohexen-1-yl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | (3S)-3-acetamido-N-[2-amino-5-(cyclohexen-1-yl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 89183175 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (3S)-3-acetamido-N-[2-amino-5-(cyclohexen-1-yl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | CC(=O)N[C@H]1CCN(C(=O)Nc2cc(C3=CCCCC3)ccc2N)C1 |
| InChI | InChI=1S/C19H26N4O2/c1-13(24)21-16-9-10-23(12-16)19(25)22-18-11-15(7-8-17(18)20)14-5-3-2-4-6-14/h5,7-8,11,16H,2-4,6,9-10,12,20H2,1H3,(H,21,24)(H,22,25)/t16-/m0/s1 |
| InChIKey | YLTSHRIOWGPEAZ-INIZCTEOSA-N |
| XLogP | 2.97 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|