About 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene
4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene (PubChem CID 159868660) has the molecular formula C26H25ClO6S2
and a molecular weight of 533.07 g/mol. Its IUPAC name is 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene.
Molecular Properties
| Compound Name | 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene |
| PubChem CID | 159868660 |
| Molecular Formula | C26H25ClO6S2 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene |
| SMILES | COc1ccc(C(=O)Cl)cc1.COc1ccc(C(=O)c2sccc2OC)cc1.COc1ccsc1 |
| InChI | InChI=1S/C13H12O3S.C8H7ClO2.C5H6OS/c1-15-10-5-3-9(4-6-10)12(14)13-11(16-2)7-8-17-13;1-11-7-4-2-6(3-5-7)8(9)10;1-6-5-2-3-7-4-5/h3-8H,1-2H3;2-5H,1H3;2-4H,1H3 |
| InChIKey | NSBALYBVJPLQAY-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene?
The IUPAC name of 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene (CID 159868660) is 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene.
What is the SMILES notation for 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene?
The canonical SMILES for 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene is COc1ccc(C(=O)Cl)cc1.COc1ccc(C(=O)c2sccc2OC)cc1.COc1ccsc1.
What is the InChIKey of 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene?
The InChIKey is NSBALYBVJPLQAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3S.C8H7ClO2.C5H6OS/c1-15-10-5-3-9(4-6-10)12(14)13-11(16-2)7-8-17-13;1-11-7-4-2-6(3-5-7)8(9)10;1-6-5-2-3-7-4-5/h3-8H,1-2H3;2-5H,1H3;2-4H,1H3.
What are the key properties of 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene?
4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene has a molecular weight of 533.07 g/mol, XLogP of 6.83, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybenzoyl chloride;(4-methoxyphenyl)-(3-methoxythiophen-2-yl)methanone;3-methoxythiophene is sourced from PubChem (CID 159868660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).