C33H50O — CID 159869020
bis[2,3-bis(3-methylbutyl)phenyl]methanone (PubChem CID 159869020) has the molecular formula C33H50O and a molecular weight of 462.76 g/mol. Its IUPAC name is bis[2,3-bis(3-methylbutyl)phenyl]methanone.
| Compound Name | bis[2,3-bis(3-methylbutyl)phenyl]methanone |
|---|---|
| PubChem CID | 159869020 |
| Molecular Formula | C33H50O |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.39 |
| IUPAC Name | bis[2,3-bis(3-methylbutyl)phenyl]methanone |
| SMILES | CC(C)CCc1cccc(C(=O)c2cccc(CCC(C)C)c2CCC(C)C)c1CCC(C)C |
| InChI | InChI=1S/C33H50O/c1-23(2)15-19-27-11-9-13-31(29(27)21-17-25(5)6)33(34)32-14-10-12-28(20-16-24(3)4)30(32)22-18-26(7)8/h9-14,23-26H,15-22H2,1-8H3 |
| InChIKey | NSCDMGIXVVDWOO-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |