About bis[2,3-bis(3-methylbutyl)phenyl]methanone
bis[2,3-bis(3-methylbutyl)phenyl]methanone (PubChem CID 159869020) has the molecular formula C33H50O
and a molecular weight of 462.76 g/mol. Its IUPAC name is bis[2,3-bis(3-methylbutyl)phenyl]methanone.
Molecular Properties
| Compound Name | bis[2,3-bis(3-methylbutyl)phenyl]methanone |
| PubChem CID | 159869020 |
| Molecular Formula | C33H50O |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.39 |
| IUPAC Name | bis[2,3-bis(3-methylbutyl)phenyl]methanone |
| SMILES | CC(C)CCc1cccc(C(=O)c2cccc(CCC(C)C)c2CCC(C)C)c1CCC(C)C |
| InChI | InChI=1S/C33H50O/c1-23(2)15-19-27-11-9-13-31(29(27)21-17-25(5)6)33(34)32-14-10-12-28(20-16-24(3)4)30(32)22-18-26(7)8/h9-14,23-26H,15-22H2,1-8H3 |
| InChIKey | NSCDMGIXVVDWOO-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bis[2,3-bis(3-methylbutyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2,3-bis(3-methylbutyl)phenyl]methanone?
The IUPAC name of bis[2,3-bis(3-methylbutyl)phenyl]methanone (CID 159869020) is bis[2,3-bis(3-methylbutyl)phenyl]methanone.
What is the SMILES notation for bis[2,3-bis(3-methylbutyl)phenyl]methanone?
The canonical SMILES for bis[2,3-bis(3-methylbutyl)phenyl]methanone is CC(C)CCc1cccc(C(=O)c2cccc(CCC(C)C)c2CCC(C)C)c1CCC(C)C.
What is the InChIKey of bis[2,3-bis(3-methylbutyl)phenyl]methanone?
The InChIKey is NSCDMGIXVVDWOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H50O/c1-23(2)15-19-27-11-9-13-31(29(27)21-17-25(5)6)33(34)32-14-10-12-28(20-16-24(3)4)30(32)22-18-26(7)8/h9-14,23-26H,15-22H2,1-8H3.
What are the key properties of bis[2,3-bis(3-methylbutyl)phenyl]methanone?
bis[2,3-bis(3-methylbutyl)phenyl]methanone has a molecular weight of 462.76 g/mol, XLogP of 9.27, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2,3-bis(3-methylbutyl)phenyl]methanone is sourced from PubChem (CID 159869020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).