C31H40BrCl2NO3 — CID 159869403
dichloromethane;3-[(2,5-dimethylphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine;hydrobromide (PubChem CID 159869403) has the molecular formula C31H40BrCl2NO3 and a molecular weight of 625.48 g/mol. Its IUPAC name is dichloromethane;3-[(2,5-dimethylphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine;hydrobromide.
| Compound Name | dichloromethane;3-[(2,5-dimethylphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine;hydrobromide |
|---|---|
| PubChem CID | 159869403 |
| Molecular Formula | C31H40BrCl2NO3 |
| Molecular Weight | 625.48 g/mol |
| Exact Mass | 623.16 |
| IUPAC Name | dichloromethane;3-[(2,5-dimethylphenyl)methoxy]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidine;hydrobromide |
| SMILES | Br.Cc1ccc(C)c(COC2CNCCC2c2ccc(OCCCOCc3ccccc3)cc2)c1.ClCCl |
| InChI | InChI=1S/C30H37NO3.CH2Cl2.BrH/c1-23-9-10-24(2)27(19-23)22-34-30-20-31-16-15-29(30)26-11-13-28(14-12-26)33-18-6-17-32-21-25-7-4-3-5-8-25;2-1-3;/h3-5,7-14,19,29-31H,6,15-18,20-22H2,1-2H3;1H2;1H |
| InChIKey | RZXCFPQBTIRQFQ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.48 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|