C25H20F2N4O2S — CID 159869809
1-fluoro-3-isothiocyanatobenzene;N-(3-fluorophenyl)-6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (PubChem CID 159869809) has the molecular formula C25H20F2N4O2S and a molecular weight of 478.52 g/mol. Its IUPAC name is 1-fluoro-3-isothiocyanatobenzene;N-(3-fluorophenyl)-6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
| Compound Name | 1-fluoro-3-isothiocyanatobenzene;N-(3-fluorophenyl)-6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 159869809 |
| Molecular Formula | C25H20F2N4O2S |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 1-fluoro-3-isothiocyanatobenzene;N-(3-fluorophenyl)-6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| SMILES | COc1cc2c(cc1OC)-c1[nH]nc(Nc3cccc(F)c3)c1C2.Fc1cccc(N=C=S)c1 |
| InChI | InChI=1S/C18H16FN3O2.C7H4FNS/c1-23-15-7-10-6-14-17(13(10)9-16(15)24-2)21-22-18(14)20-12-5-3-4-11(19)8-12;8-6-2-1-3-7(4-6)9-5-10/h3-5,7-9H,6H2,1-2H3,(H2,20,21,22);1-4H |
| InChIKey | NSEUWJMNCNVEFM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|