C18H17N3O3 — CID 18445564
3-[(6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-yl)amino]phenol (PubChem CID 18445564) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-[(6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-yl)amino]phenol.
| Compound Name | 3-[(6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-yl)amino]phenol |
|---|---|
| PubChem CID | 18445564 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-[(6,7-dimethoxy-1,4-dihydroindeno[2,1-d]pyrazol-3-yl)amino]phenol |
| SMILES | COc1cc2c(cc1OC)-c1[nH]nc(Nc3cccc(O)c3)c1C2 |
| InChI | InChI=1S/C18H17N3O3/c1-23-15-7-10-6-14-17(13(10)9-16(15)24-2)20-21-18(14)19-11-4-3-5-12(22)8-11/h3-5,7-9,22H,6H2,1-2H3,(H2,19,20,21) |
| InChIKey | HIIXMFPTEPGMJN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |