About methanesulfonic acid;methylphosphonic acid;nitromethane
methanesulfonic acid;methylphosphonic acid;nitromethane (PubChem CID 159871044) has the molecular formula C3H12NO8PS
and a molecular weight of 253.17 g/mol. Its IUPAC name is methanesulfonic acid;methylphosphonic acid;nitromethane.
Molecular Properties
| Compound Name | methanesulfonic acid;methylphosphonic acid;nitromethane |
| PubChem CID | 159871044 |
| Molecular Formula | C3H12NO8PS |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | methanesulfonic acid;methylphosphonic acid;nitromethane |
| SMILES | CP(=O)(O)O.CS(=O)(=O)O.C[N+](=O)[O-] |
| InChI | InChI=1S/CH3NO2.CH5O3P.CH4O3S/c1-2(3)4;2*1-5(2,3)4/h1H3;1H3,(H2,2,3,4);1H3,(H,2,3,4) |
| InChIKey | AQOIQSMUDOHVDX-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;methylphosphonic acid;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;methylphosphonic acid;nitromethane?
The IUPAC name of methanesulfonic acid;methylphosphonic acid;nitromethane (CID 159871044) is methanesulfonic acid;methylphosphonic acid;nitromethane.
What is the SMILES notation for methanesulfonic acid;methylphosphonic acid;nitromethane?
The canonical SMILES for methanesulfonic acid;methylphosphonic acid;nitromethane is CP(=O)(O)O.CS(=O)(=O)O.C[N+](=O)[O-].
What is the InChIKey of methanesulfonic acid;methylphosphonic acid;nitromethane?
The InChIKey is AQOIQSMUDOHVDX-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO2.CH5O3P.CH4O3S/c1-2(3)4;2*1-5(2,3)4/h1H3;1H3,(H2,2,3,4);1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;methylphosphonic acid;nitromethane?
methanesulfonic acid;methylphosphonic acid;nitromethane has a molecular weight of 253.17 g/mol, XLogP of -0.81, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;methylphosphonic acid;nitromethane is sourced from PubChem (CID 159871044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).