About CID 159871372
CID 159871372 (PubChem CID 159871372) has the molecular formula H3BNa3O3
and a molecular weight of 130.80 g/mol.
Molecular Properties
| Compound Name | CID 159871372 |
| PubChem CID | 159871372 |
| Molecular Formula | H3BNa3O3 |
| Molecular Weight | 130.80 g/mol |
| Exact Mass | 130.99 |
| IUPAC Name | — |
| SMILES | OB(O)O.[Na].[Na].[Na] |
| InChI | InChI=1S/BH3O3.3Na/c2-1(3)4;;;/h2-4H;;; |
| InChIKey | NSJUABOWQSLBEJ-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.80 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159871372 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159871372?
The IUPAC name of CID 159871372 (CID 159871372) is not available.
What is the SMILES notation for CID 159871372?
The canonical SMILES for CID 159871372 is OB(O)O.[Na].[Na].[Na].
What is the InChIKey of CID 159871372?
The InChIKey is NSJUABOWQSLBEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/BH3O3.3Na/c2-1(3)4;;;/h2-4H;;;.
What are the key properties of CID 159871372?
CID 159871372 has a molecular weight of 130.80 g/mol, XLogP of -3.19, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159871372 is sourced from PubChem (CID 159871372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).