C36H43Br2ClN8O8 — CID 159871938
6-bromo-4-chloro-3-nitroquinoline;tert-butyl (3R)-3-aminopyrrolidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 159871938) has the molecular formula C36H43Br2ClN8O8 and a molecular weight of 911.05 g/mol. Its IUPAC name is 6-bromo-4-chloro-3-nitroquinoline;tert-butyl (3R)-3-aminopyrrolidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | 6-bromo-4-chloro-3-nitroquinoline;tert-butyl (3R)-3-aminopyrrolidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 159871938 |
| Molecular Formula | C36H43Br2ClN8O8 |
| Molecular Weight | 911.05 g/mol |
| Exact Mass | 908.13 |
| IUPAC Name | 6-bromo-4-chloro-3-nitroquinoline;tert-butyl (3R)-3-aminopyrrolidine-1-carboxylate;tert-butyl (3R)-3-[(6-bromo-3-nitroquinolin-4-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](N)C1.CC(C)(C)OC(=O)N1CC[C@@H](Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)C1.O=[N+]([O-])c1cnc2ccc(Br)cc2c1Cl |
| InChI | InChI=1S/C18H21BrN4O4.C9H4BrClN2O2.C9H18N2O2/c1-18(2,3)27-17(24)22-7-6-12(10-22)21-16-13-8-11(19)4-5-14(13)20-9-15(16)23(25)26;10-5-1-2-7-6(3-5)9(11)8(4-12-7)13(14)15;1-9(2,3)13-8(12)11-5-4-7(10)6-11/h4-5,8-9,12H,6-7,10H2,1-3H3,(H,20,21);1-4H;7H,4-6,10H2,1-3H3/t12-;;7-/m1.1/s1 |
| InChIKey | NSLQZKIWQUUPDO-PVOIQKRISA-N |
| XLogP | 8.84 |
| TPSA | 209.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.05 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|