C25H35N7O2S — CID 15987249
2-[4-[2-methylsulfanyl-6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 15987249) has the molecular formula C25H35N7O2S and a molecular weight of 497.67 g/mol. Its IUPAC name is 2-[4-[2-methylsulfanyl-6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[2-methylsulfanyl-6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 15987249 |
| Molecular Formula | C25H35N7O2S |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 2-[4-[2-methylsulfanyl-6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | CSc1nc(Nc2ccc(N3CCOCC3)cc2)cc(N2CCN(CC(=O)N3CCCC3)CC2)n1 |
| InChI | InChI=1S/C25H35N7O2S/c1-35-25-27-22(26-20-4-6-21(7-5-20)30-14-16-34-17-15-30)18-23(28-25)31-12-10-29(11-13-31)19-24(33)32-8-2-3-9-32/h4-7,18H,2-3,8-17,19H2,1H3,(H,26,27,28) |
| InChIKey | GYBDCDFXNILULE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|