C21H28N6O3S — CID 10173645
2-[4-[2-methylsulfanyl-6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]acetic acid (PubChem CID 10173645) has the molecular formula C21H28N6O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-[4-[2-methylsulfanyl-6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[2-methylsulfanyl-6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10173645 |
| Molecular Formula | C21H28N6O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-[4-[2-methylsulfanyl-6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]acetic acid |
| SMILES | CSc1nc(Nc2ccc(N3CCOCC3)cc2)cc(N2CCN(CC(=O)O)CC2)n1 |
| InChI | InChI=1S/C21H28N6O3S/c1-31-21-23-18(14-19(24-21)27-8-6-25(7-9-27)15-20(28)29)22-16-2-4-17(5-3-16)26-10-12-30-13-11-26/h2-5,14H,6-13,15H2,1H3,(H,28,29)(H,22,23,24) |
| InChIKey | BZXKZYQUKROYBA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|