C22H25N5OS — CID 99968574
6-(4-methylpiperazin-1-yl)-2-methylsulfanyl-N-(4-phenoxyphenyl)pyrimidin-4-amine (PubChem CID 99968574) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-2-methylsulfanyl-N-(4-phenoxyphenyl)pyrimidin-4-amine.
| Compound Name | 6-(4-methylpiperazin-1-yl)-2-methylsulfanyl-N-(4-phenoxyphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 99968574 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-2-methylsulfanyl-N-(4-phenoxyphenyl)pyrimidin-4-amine |
| SMILES | CSc1nc(Nc2ccc(Oc3ccccc3)cc2)cc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C22H25N5OS/c1-26-12-14-27(15-13-26)21-16-20(24-22(25-21)29-2)23-17-8-10-19(11-9-17)28-18-6-4-3-5-7-18/h3-11,16H,12-15H2,1-2H3,(H,23,24,25) |
| InChIKey | VSBSBVDGTMBDIX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |