C25H30N6O — CID 57399456
N-(4-methoxyphenyl)-6-(4-phenylpiperazin-1-yl)-2-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 57399456) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-6-(4-phenylpiperazin-1-yl)-2-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-(4-methoxyphenyl)-6-(4-phenylpiperazin-1-yl)-2-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 57399456 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | N-(4-methoxyphenyl)-6-(4-phenylpiperazin-1-yl)-2-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | COc1ccc(Nc2cc(N3CCN(c4ccccc4)CC3)nc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C25H30N6O/c1-32-22-11-9-20(10-12-22)26-23-19-24(28-25(27-23)31-13-5-6-14-31)30-17-15-29(16-18-30)21-7-3-2-4-8-21/h2-4,7-12,19H,5-6,13-18H2,1H3,(H,26,27,28) |
| InChIKey | RRCQRNGBGBGOTP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |