C18H25N5OS — CID 99968578
N-(2-methoxy-5-methylphenyl)-6-(4-methylpiperazin-1-yl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 99968578) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-6-(4-methylpiperazin-1-yl)-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-(2-methoxy-5-methylphenyl)-6-(4-methylpiperazin-1-yl)-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 99968578 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-6-(4-methylpiperazin-1-yl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | COc1ccc(C)cc1Nc1cc(N2CCN(C)CC2)nc(SC)n1 |
| InChI | InChI=1S/C18H25N5OS/c1-13-5-6-15(24-3)14(11-13)19-16-12-17(21-18(20-16)25-4)23-9-7-22(2)8-10-23/h5-6,11-12H,7-10H2,1-4H3,(H,19,20,21) |
| InChIKey | JLAJHEIZIYRMIC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |