C20H30O5 — CID 159872697
ethyl 2-[(3R,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ylidene]acetate (PubChem CID 159872697) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is ethyl 2-[(3R,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ylidene]acetate.
| Compound Name | ethyl 2-[(3R,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ylidene]acetate |
|---|---|
| PubChem CID | 159872697 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | ethyl 2-[(3R,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ylidene]acetate |
| SMILES | CCOC(=O)C=C1CC[C@]2(CO2)C(C2(C)O[C@@H]2CC=C(C)C)[C@@H]1OC |
| InChI | InChI=1S/C20H30O5/c1-6-23-16(21)11-14-9-10-20(12-24-20)18(17(14)22-5)19(4)15(25-19)8-7-13(2)3/h7,11,15,17-18H,6,8-10,12H2,1-5H3/t15-,17-,18?,19?,20+/m1/s1 |
| InChIKey | MSCPRPGCNYYAJK-UCSKNUCCSA-N |
| XLogP | 3.18 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|