C18H26O5 — CID 88930947
(2Z)-2-[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ylidene]acetic acid (PubChem CID 88930947) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is (2Z)-2-[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ylidene]acetic acid.
| Compound Name | (2Z)-2-[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ylidene]acetic acid |
|---|---|
| PubChem CID | 88930947 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (2Z)-2-[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ylidene]acetic acid |
| SMILES | CO[C@@H]1/C(=C\C(=O)O)CC[C@]2(CO2)[C@H]1C1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C18H26O5/c1-11(2)5-6-13-17(3,23-13)16-15(21-4)12(9-14(19)20)7-8-18(16)10-22-18/h5,9,13,15-16H,6-8,10H2,1-4H3,(H,19,20)/b12-9-/t13-,15-,16-,17?,18+/m1/s1 |
| InChIKey | HSHFAYHWPULDOA-XLRVWWBCSA-N |
| XLogP | 2.71 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|