C25H20F3N3O2 — CID 15987555
N-[1-benzyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]-4-methylbenzamide (PubChem CID 15987555) has the molecular formula C25H20F3N3O2 and a molecular weight of 451.45 g/mol. Its IUPAC name is N-[1-benzyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]-4-methylbenzamide.
| Compound Name | N-[1-benzyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 15987555 |
| Molecular Formula | C25H20F3N3O2 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-[1-benzyl-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2(C(F)(F)F)N=C(c3ccccc3)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H20F3N3O2/c1-17-12-14-20(15-13-17)22(32)30-24(25(26,27)28)23(33)31(16-18-8-4-2-5-9-18)21(29-24)19-10-6-3-7-11-19/h2-15H,16H2,1H3,(H,30,32) |
| InChIKey | PZYLDOPQYSARIS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |