C32H41N — CID 159876086
2,5-dimethylpyridine;1,2,4-trimethylbenzene;1,3-xylene;1,4-xylene (PubChem CID 159876086) has the molecular formula C32H41N and a molecular weight of 439.69 g/mol. Its IUPAC name is 2,5-dimethylpyridine;1,2,4-trimethylbenzene;1,3-xylene;1,4-xylene.
| Compound Name | 2,5-dimethylpyridine;1,2,4-trimethylbenzene;1,3-xylene;1,4-xylene |
|---|---|
| PubChem CID | 159876086 |
| Molecular Formula | C32H41N |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.32 |
| IUPAC Name | 2,5-dimethylpyridine;1,2,4-trimethylbenzene;1,3-xylene;1,4-xylene |
| SMILES | Cc1ccc(C)c(C)c1.Cc1ccc(C)cc1.Cc1ccc(C)nc1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C9H12.2C8H10.C7H9N/c1-7-4-5-8(2)9(3)6-7;1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7;1-6-3-4-7(2)8-5-6/h4-6H,1-3H3;2*3-6H,1-2H3;3-5H,1-2H3 |
| InChIKey | NSXQYTBRFGERJJ-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |