C14H21N — CID 145048152
ethane;2,7,9-trimethylazecine (PubChem CID 145048152) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;2,7,9-trimethylazecine.
| Compound Name | ethane;2,7,9-trimethylazecine |
|---|---|
| PubChem CID | 145048152 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;2,7,9-trimethylazecine |
| SMILES | CC.Cc1ccccc(C)ncc(C)c1 |
| InChI | InChI=1S/C12H15N.C2H6/c1-10-6-4-5-7-12(3)13-9-11(2)8-10;1-2/h4-9H,1-3H3;1-2H3/b5-4-,6-4-,7-5-,10-6+,10-8+,11-8-,11-9-,12-7+,13-9-,13-12+; |
| InChIKey | JZISDWZZKFUSLU-ANRFECQTSA-N |
| XLogP | 4.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |