C25H30N4O3 — CID 15987645
N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3,5-dimethoxybenzamide (PubChem CID 15987645) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 15987645 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3,5-dimethoxybenzamide |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=O)c4cc(OC)cc(OC)c4)ccc3n2)CC1 |
| InChI | InChI=1S/C25H30N4O3/c1-5-28-8-10-29(11-9-28)24-12-17(2)22-15-19(6-7-23(22)27-24)26-25(30)18-13-20(31-3)16-21(14-18)32-4/h6-7,12-16H,5,8-11H2,1-4H3,(H,26,30) |
| InChIKey | CJDFEASPARUQMH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |