C26H27F3N4O2 — CID 11496739
(E)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 11496739) has the molecular formula C26H27F3N4O2 and a molecular weight of 484.52 g/mol. Its IUPAC name is (E)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11496739 |
| Molecular Formula | C26H27F3N4O2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (E)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=O)/C=C/c4ccc(OC(F)(F)F)cc4)ccc3n2)CC1 |
| InChI | InChI=1S/C26H27F3N4O2/c1-3-32-12-14-33(15-13-32)24-16-18(2)22-17-20(7-10-23(22)31-24)30-25(34)11-6-19-4-8-21(9-5-19)35-26(27,28)29/h4-11,16-17H,3,12-15H2,1-2H3,(H,30,34)/b11-6+ |
| InChIKey | WYHCKMLXSRWVQF-IZZDOVSWSA-N |
| XLogP | 5.24 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|