C18H16N2O2S — CID 159878091
N-(1,7-dimethyl-3H-inden-4-yl)-4-isocyanobenzenesulfonamide (PubChem CID 159878091) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is N-(1,7-dimethyl-3H-inden-4-yl)-4-isocyanobenzenesulfonamide.
| Compound Name | N-(1,7-dimethyl-3H-inden-4-yl)-4-isocyanobenzenesulfonamide |
|---|---|
| PubChem CID | 159878091 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-(1,7-dimethyl-3H-inden-4-yl)-4-isocyanobenzenesulfonamide |
| SMILES | [C-]#[N+]c1ccc(S(=O)(=O)Nc2ccc(C)c3c2CC=C3C)cc1 |
| InChI | InChI=1S/C18H16N2O2S/c1-12-4-10-16-17(11-5-13(2)18(12)16)20-23(21,22)15-8-6-14(19-3)7-9-15/h4-9,11,20H,10H2,1-2H3 |
| InChIKey | ULCKCLWCTWSFLJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|